C36H27N — CID 92856996
(3S)-2,3,4,5,6-pentakis-phenyl-3H-azepine (PubChem CID 92856996) has the molecular formula C36H27N and a molecular weight of 473.62 g/mol. Its IUPAC name is (3S)-2,3,4,5,6-pentakis-phenyl-3H-azepine.
| Compound Name | (3S)-2,3,4,5,6-pentakis-phenyl-3H-azepine |
|---|---|
| PubChem CID | 92856996 |
| Molecular Formula | C36H27N |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (3S)-2,3,4,5,6-pentakis-phenyl-3H-azepine |
| SMILES | C1=C(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)[C@H](c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C36H27N/c1-6-16-27(17-7-1)32-26-37-36(31-24-14-5-15-25-31)35(30-22-12-4-13-23-30)34(29-20-10-3-11-21-29)33(32)28-18-8-2-9-19-28/h1-26,35H/t35-/m0/s1 |
| InChIKey | BMHHJGYDAZHKQN-DHUJRADRSA-N |
| XLogP | 8.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|