C18H23NO3 — CID 92857641
(2E,5S)-2-[(4-methoxyphenyl)methylidene]-5-(morpholin-4-ylmethyl)cyclopentan-1-one (PubChem CID 92857641) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2E,5S)-2-[(4-methoxyphenyl)methylidene]-5-(morpholin-4-ylmethyl)cyclopentan-1-one.
| Compound Name | (2E,5S)-2-[(4-methoxyphenyl)methylidene]-5-(morpholin-4-ylmethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 92857641 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (2E,5S)-2-[(4-methoxyphenyl)methylidene]-5-(morpholin-4-ylmethyl)cyclopentan-1-one |
| SMILES | COc1ccc(/C=C2\CC[C@@H](CN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-21-17-6-2-14(3-7-17)12-15-4-5-16(18(15)20)13-19-8-10-22-11-9-19/h2-3,6-7,12,16H,4-5,8-11,13H2,1H3/b15-12+/t16-/m0/s1 |
| InChIKey | YHJFMYKYQWCQPY-STTHAQSSSA-N |
| XLogP | 2.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|