C24H28ClNO4 — CID 10622515
[(3E)-3-[[4-(4-methoxybenzoyl)oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride (PubChem CID 10622515) has the molecular formula C24H28ClNO4 and a molecular weight of 429.94 g/mol. Its IUPAC name is [(3E)-3-[[4-(4-methoxybenzoyl)oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride.
| Compound Name | [(3E)-3-[[4-(4-methoxybenzoyl)oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 10622515 |
| Molecular Formula | C24H28ClNO4 |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [(3E)-3-[[4-(4-methoxybenzoyl)oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C3\CCCC(C[NH+](C)C)C3=O)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C24H27NO4.ClH/c1-25(2)16-20-6-4-5-19(23(20)26)15-17-7-11-22(12-8-17)29-24(27)18-9-13-21(28-3)14-10-18;/h7-15,20H,4-6,16H2,1-3H3;1H/b19-15+; |
| InChIKey | DUTFAXBGQCFYLB-QTCZRQAZSA-N |
| XLogP | -0.18 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|