C25H26Cl3NO3 — CID 10505382
[(3E)-3-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride (PubChem CID 10505382) has the molecular formula C25H26Cl3NO3 and a molecular weight of 494.85 g/mol. Its IUPAC name is [(3E)-3-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride.
| Compound Name | [(3E)-3-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 10505382 |
| Molecular Formula | C25H26Cl3NO3 |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [(3E)-3-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxyphenyl]methylidene]-2-oxocyclohexyl]methyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CC1CCC/C(=C\c2ccc(OC(=O)/C=C/c3ccc(Cl)c(Cl)c3)cc2)C1=O.[Cl-] |
| InChI | InChI=1S/C25H25Cl2NO3.ClH/c1-28(2)16-20-5-3-4-19(25(20)30)14-17-6-10-21(11-7-17)31-24(29)13-9-18-8-12-22(26)23(27)15-18;/h6-15,20H,3-5,16H2,1-2H3;1H/b13-9+,19-14+; |
| InChIKey | OYQPNDAKJQAUBD-YITQAVLPSA-N |
| XLogP | 1.51 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|