C23H25Cl2NO3 — CID 5470076
[4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] 4-chlorobenzoate;hydrochloride (PubChem CID 5470076) has the molecular formula C23H25Cl2NO3 and a molecular weight of 434.36 g/mol. Its IUPAC name is [4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] 4-chlorobenzoate;hydrochloride.
| Compound Name | [4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] 4-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 5470076 |
| Molecular Formula | C23H25Cl2NO3 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] 4-chlorobenzoate;hydrochloride |
| SMILES | CN(C)CC1CCC/C(=C\c2ccc(OC(=O)c3ccc(Cl)cc3)cc2)C1=O.Cl |
| InChI | InChI=1S/C23H24ClNO3.ClH/c1-25(2)15-19-5-3-4-18(22(19)26)14-16-6-12-21(13-7-16)28-23(27)17-8-10-20(24)11-9-17;/h6-14,19H,3-5,15H2,1-2H3;1H/b18-14+; |
| InChIKey | HJCIZFCRZJNNMW-LSJACRKWSA-N |
| XLogP | 5.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|