C25H25Cl2NO3 — CID 6914209
[4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 6914209) has the molecular formula C25H25Cl2NO3 and a molecular weight of 458.39 g/mol. Its IUPAC name is [4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6914209 |
| Molecular Formula | C25H25Cl2NO3 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [4-[(E)-[3-[(dimethylamino)methyl]-2-oxocyclohexylidene]methyl]phenyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | CN(C)CC1CCC/C(=C\c2ccc(OC(=O)/C=C/c3ccc(Cl)c(Cl)c3)cc2)C1=O |
| InChI | InChI=1S/C25H25Cl2NO3/c1-28(2)16-20-5-3-4-19(25(20)30)14-17-6-10-21(11-7-17)31-24(29)13-9-18-8-12-22(26)23(27)15-18/h6-15,20H,3-5,16H2,1-2H3/b13-9+,19-14+ |
| InChIKey | GVDVILCHMUMRCB-QZTGBSOPSA-N |
| XLogP | 5.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|