About (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane
(7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane (PubChem CID 92858965) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane |
| PubChem CID | 92858965 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane |
| SMILES | CC1(C)CN(Cc2ccccc2)CCO[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-18(2)15-19(14-16-6-4-3-5-7-16)8-13-22-17(18)20-9-11-21-12-10-20/h3-7,17H,8-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | ITRDUFRBZQOUCA-KRWDZBQOSA-N |
| XLogP | 2.20 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane?
The IUPAC name of (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane (CID 92858965) is (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane.
What is the SMILES notation for (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane?
The canonical SMILES for (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane is CC1(C)CN(Cc2ccccc2)CCO[C@@H]1N1CCOCC1.
What is the InChIKey of (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane?
The InChIKey is ITRDUFRBZQOUCA-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H28N2O2/c1-18(2)15-19(14-16-6-4-3-5-7-16)8-13-22-17(18)20-9-11-21-12-10-20/h3-7,17H,8-15H2,1-2H3/t17-/m0/s1.
What are the key properties of (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane?
(7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane has a molecular weight of 304.43 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-4-benzyl-6,6-dimethyl-7-morpholin-4-yl-1,4-oxazepane is sourced from PubChem (CID 92858965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).