C25H29N3O6S — CID 92867170
(3aS,7aS)-2-[[3-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-4-methylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 92867170) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is (3aS,7aS)-2-[[3-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-4-methylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[[3-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-4-methylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92867170 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (3aS,7aS)-2-[[3-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-4-methylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)cc1S(=O)(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C25H29N3O6S/c1-17-8-9-18(16-28-23(29)19-5-2-3-6-20(19)24(28)30)15-22(17)35(32,33)27-12-10-26(11-13-27)25(31)21-7-4-14-34-21/h4,7-9,14-15,19-20H,2-3,5-6,10-13,16H2,1H3/t19-,20-/m0/s1 |
| InChIKey | YZJLCOGGYBIUMW-PMACEKPBSA-N |
| XLogP | 2.41 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|