C26H31N3O4S — CID 98226670
(3aR,7aR)-2-[[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 98226670) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is (3aR,7aR)-2-[[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98226670 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (3aR,7aR)-2-[[4-methyl-3-(4-phenylpiperazin-1-yl)sulfonylphenyl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(CN2C(=O)[C@@H]3CCCC[C@H]3C2=O)cc1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O4S/c1-19-11-12-20(18-29-25(30)22-9-5-6-10-23(22)26(29)31)17-24(19)34(32,33)28-15-13-27(14-16-28)21-7-3-2-4-8-21/h2-4,7-8,11-12,17,22-23H,5-6,9-10,13-16,18H2,1H3/t22-,23-/m1/s1 |
| InChIKey | NFDXQXAOXFKHIB-DHIUTWEWSA-N |
| XLogP | 3.18 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|