C23H25N3O5S — CID 92882642
N-(2,5-dimethoxyphenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide (PubChem CID 92882642) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 92882642 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[(2R)-3-oxo-2-(pyrrolidine-1-carbonyl)-1,4-benzothiazin-4-yl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN2C(=O)[C@@H](C(=O)N3CCCC3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C23H25N3O5S/c1-30-15-9-10-18(31-2)16(13-15)24-20(27)14-26-17-7-3-4-8-19(17)32-21(23(26)29)22(28)25-11-5-6-12-25/h3-4,7-10,13,21H,5-6,11-12,14H2,1-2H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | PJTOLDGEXXNRCH-OAQYLSRUSA-N |
| XLogP | 2.77 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|