C27H41N7O2 — CID 92889206
(3S)-1-(4-methyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 92889206) has the molecular formula C27H41N7O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is (3S)-1-(4-methyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-methyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92889206 |
| Molecular Formula | C27H41N7O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | (3S)-1-(4-methyl-3-oxopyrido[2,3-b]pyrazin-2-yl)-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | Cn1c(=O)c(N2CCC[C@H](C(=O)NCCCN3CCC(N4CCCCC4)CC3)C2)nc2cccnc21 |
| InChI | InChI=1S/C27H41N7O2/c1-31-24-23(9-5-12-28-24)30-25(27(31)36)34-17-6-8-21(20-34)26(35)29-13-7-14-32-18-10-22(11-19-32)33-15-3-2-4-16-33/h5,9,12,21-22H,2-4,6-8,10-11,13-20H2,1H3,(H,29,35)/t21-/m0/s1 |
| InChIKey | NJLJKKYYFMLQRI-NRFANRHFSA-N |
| XLogP | 2.00 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|