C20H22ClNO3S2 — CID 92901701
7-chloro-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 92901701) has the molecular formula C20H22ClNO3S2 and a molecular weight of 423.99 g/mol. Its IUPAC name is 7-chloro-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | 7-chloro-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 92901701 |
| Molecular Formula | C20H22ClNO3S2 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 7-chloro-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)c1cc2c(s1)-c1ccc(Cl)cc1S(=O)(=O)C2 |
| InChI | InChI=1S/C20H22ClNO3S2/c1-11-4-3-5-16(12(11)2)22-20(23)17-8-13-10-27(24,25)18-9-14(21)6-7-15(18)19(13)26-17/h6-9,11-12,16H,3-5,10H2,1-2H3,(H,22,23)/t11-,12-,16+/m1/s1 |
| InChIKey | UAZGGIDTDZMTQK-HSMVNMDESA-N |
| XLogP | 4.91 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |