C18H21F3N2O3 — CID 92902938
1-[(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dimethylphenoxy)ethanone (PubChem CID 92902938) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 1-[(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dimethylphenoxy)ethanone.
| Compound Name | 1-[(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 92902938 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(2,4-dimethylphenoxy)ethanone |
| SMILES | Cc1ccc(OCC(=O)N2N=C3CCCC[C@@H]3[C@]2(O)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C18H21F3N2O3/c1-11-7-8-15(12(2)9-11)26-10-16(24)23-17(25,18(19,20)21)13-5-3-4-6-14(13)22-23/h7-9,13,25H,3-6,10H2,1-2H3/t13-,17-/m0/s1 |
| InChIKey | OXNMBPDEBFMDTO-GUYCJALGSA-N |
| XLogP | 3.32 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |