C16H23N3O4S — CID 9291909
4-[2-[[(S)-(4-ethyl-3-methyl-5-oxo-2H-pyrrol-1-yl)-hydroxymethyl]amino]ethyl]benzenesulfonamide (PubChem CID 9291909) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[2-[[(S)-(4-ethyl-3-methyl-5-oxo-2H-pyrrol-1-yl)-hydroxymethyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[(S)-(4-ethyl-3-methyl-5-oxo-2H-pyrrol-1-yl)-hydroxymethyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9291909 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[2-[[(S)-(4-ethyl-3-methyl-5-oxo-2H-pyrrol-1-yl)-hydroxymethyl]amino]ethyl]benzenesulfonamide |
| SMILES | CCC1=C(C)CN([C@@H](O)NCCc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C16H23N3O4S/c1-3-14-11(2)10-19(15(14)20)16(21)18-9-8-12-4-6-13(7-5-12)24(17,22)23/h4-7,16,18,21H,3,8-10H2,1-2H3,(H2,17,22,23)/t16-/m0/s1 |
| InChIKey | QVACVXSDJMOBPS-INIZCTEOSA-N |
| XLogP | 0.31 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|