C21H30N4O4 — CID 9295432
(2R)-2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 9295432) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is (2R)-2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2R)-2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 9295432 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (2R)-2-[(4S)-4-butyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CCCC[C@]1(C)NC(=O)N([C@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C21H30N4O4/c1-4-5-10-21(3)19(27)25(20(28)23-21)15(2)18(26)22-16-6-8-17(9-7-16)24-11-13-29-14-12-24/h6-9,15H,4-5,10-14H2,1-3H3,(H,22,26)(H,23,28)/t15-,21+/m1/s1 |
| InChIKey | AAOIQKFDXQVMNK-VFNWGFHPSA-N |
| XLogP | 2.35 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|