C23H34N4O4 — CID 9329126
(2S)-2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 9329126) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2S)-2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 9329126 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | (2S)-2-[(4R)-4-hexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CCCCCC[C@@]1(C)NC(=O)N([C@@H](C)C(=O)Nc2ccc(N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C23H34N4O4/c1-4-5-6-7-12-23(3)21(29)27(22(30)25-23)17(2)20(28)24-18-8-10-19(11-9-18)26-13-15-31-16-14-26/h8-11,17H,4-7,12-16H2,1-3H3,(H,24,28)(H,25,30)/t17-,23+/m0/s1 |
| InChIKey | ZSTUVYWVCQVGDD-GAJHUEQPSA-N |
| XLogP | 3.13 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|