About (2R)-2-nitropropanoic acid
(2R)-2-nitropropanoic acid (PubChem CID 92979979) has the molecular formula C3H5NO4
and a molecular weight of 119.08 g/mol. Its IUPAC name is (2R)-2-nitropropanoic acid.
Molecular Properties
| Compound Name | (2R)-2-nitropropanoic acid |
| PubChem CID | 92979979 |
| Molecular Formula | C3H5NO4 |
| Molecular Weight | 119.08 g/mol |
| Exact Mass | 119.02 |
| IUPAC Name | (2R)-2-nitropropanoic acid |
| SMILES | C[C@H](C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C3H5NO4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)/t2-/m1/s1 |
| InChIKey | PTYVBEKOPJHZLJ-UWTATZPHSA-N |
| XLogP | -0.26 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.08 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-nitropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-nitropropanoic acid?
The IUPAC name of (2R)-2-nitropropanoic acid (CID 92979979) is (2R)-2-nitropropanoic acid.
What is the SMILES notation for (2R)-2-nitropropanoic acid?
The canonical SMILES for (2R)-2-nitropropanoic acid is C[C@H](C(=O)O)[N+](=O)[O-].
What is the InChIKey of (2R)-2-nitropropanoic acid?
The InChIKey is PTYVBEKOPJHZLJ-UWTATZPHSA-N. The full InChI is InChI=1S/C3H5NO4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)/t2-/m1/s1.
What are the key properties of (2R)-2-nitropropanoic acid?
(2R)-2-nitropropanoic acid has a molecular weight of 119.08 g/mol, XLogP of -0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-nitropropanoic acid is sourced from PubChem (CID 92979979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).