C8H16N2S — CID 93021744
[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 93021744) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is [(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | [(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 93021744 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | [(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(N)=S |
| InChI | InChI=1S/C8H16N2S/c1-6-4-2-3-5-7(6)10-8(9)11/h6-7H,2-5H2,1H3,(H3,9,10,11)/t6-,7+/m1/s1 |
| InChIKey | CAOMLGGTPPGEFR-RQJHMYQMSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|