C11H17F3N2S — CID 97005333
1-cyclopropyl-3-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]thiourea (PubChem CID 97005333) has the molecular formula C11H17F3N2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]thiourea |
|---|---|
| PubChem CID | 97005333 |
| Molecular Formula | C11H17F3N2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-cyclopropyl-3-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]thiourea |
| SMILES | FC(F)(F)[C@H]1CCCC[C@@H]1NC(=S)NC1CC1 |
| InChI | InChI=1S/C11H17F3N2S/c12-11(13,14)8-3-1-2-4-9(8)16-10(17)15-7-5-6-7/h7-9H,1-6H2,(H2,15,16,17)/t8-,9-/m0/s1 |
| InChIKey | DQPYURCJHSPKEC-IUCAKERBSA-N |
| XLogP | 2.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|