C30H31N3O3 — CID 93061893
2-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(2R)-4-phenylbutan-2-yl]benzamide (PubChem CID 93061893) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(2R)-4-phenylbutan-2-yl]benzamide.
| Compound Name | 2-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(2R)-4-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 93061893 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-[[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]methyl]-N-[(2R)-4-phenylbutan-2-yl]benzamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)c1ccccc1CN1C(=O)[C@@H]2CCCN2C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H31N3O3/c1-21(17-18-22-10-3-2-4-11-22)31-28(34)24-13-6-5-12-23(24)20-33-26-15-8-7-14-25(26)29(35)32-19-9-16-27(32)30(33)36/h2-8,10-15,21,27H,9,16-20H2,1H3,(H,31,34)/t21-,27+/m1/s1 |
| InChIKey | LBJHMPCBABCMIP-ZBLYBZFDSA-N |
| XLogP | 4.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |