C22H24ClNO4 — CID 9313796
(4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(2,3-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 9313796) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is (4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(2,3-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(2,3-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313796 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (4Z)-2-[(5S,7R)-3-chloro-1-adamantyl]-4-[(2,3-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cccc(/C=C2\N=C(C34C[C@@H]5C[C@@H](CC(Cl)(C5)C3)C4)OC2=O)c1OC |
| InChI | InChI=1S/C22H24ClNO4/c1-26-17-5-3-4-15(18(17)27-2)7-16-19(25)28-20(24-16)21-8-13-6-14(9-21)11-22(23,10-13)12-21/h3-5,7,13-14H,6,8-12H2,1-2H3/b16-7-/t13-,14+,21?,22? |
| InChIKey | NSLZKJSWFLTBFO-XYOMDARISA-N |
| XLogP | 4.58 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|