C20H26F2N2O4 — CID 93144270
(3R)-4-(3,5-difluorobenzoyl)-N-(2-methoxyethyl)-8-methyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide (PubChem CID 93144270) has the molecular formula C20H26F2N2O4 and a molecular weight of 396.43 g/mol. Its IUPAC name is (3R)-4-(3,5-difluorobenzoyl)-N-(2-methoxyethyl)-8-methyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3R)-4-(3,5-difluorobenzoyl)-N-(2-methoxyethyl)-8-methyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 93144270 |
| Molecular Formula | C20H26F2N2O4 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (3R)-4-(3,5-difluorobenzoyl)-N-(2-methoxyethyl)-8-methyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1COC2(CCC(C)CC2)N1C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H26F2N2O4/c1-13-3-5-20(6-4-13)24(17(12-28-20)18(25)23-7-8-27-2)19(26)14-9-15(21)11-16(22)10-14/h9-11,13,17H,3-8,12H2,1-2H3,(H,23,25)/t13?,17-,20?/m1/s1 |
| InChIKey | RSKIJOIFBHXSMS-DJMMNXNOSA-N |
| XLogP | 2.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|