C18H29NO3 — CID 93166056
(2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-methylpropyl)amino]-2-methylbut-3-en-2-ol (PubChem CID 93166056) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-methylpropyl)amino]-2-methylbut-3-en-2-ol.
| Compound Name | (2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-methylpropyl)amino]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 93166056 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2S)-1-[(3,4-dimethoxyphenyl)methyl-(2-methylpropyl)amino]-2-methylbut-3-en-2-ol |
| SMILES | C=C[C@](C)(O)CN(Cc1ccc(OC)c(OC)c1)CC(C)C |
| InChI | InChI=1S/C18H29NO3/c1-7-18(4,20)13-19(11-14(2)3)12-15-8-9-16(21-5)17(10-15)22-6/h7-10,14,20H,1,11-13H2,2-6H3/t18-/m0/s1 |
| InChIKey | JVKKZRSAOYZQAV-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|