C16H23N4O4S+ — CID 9317969
methyl-[2-oxo-2-(propan-2-ylamino)ethyl]-[[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]methyl]azanium (PubChem CID 9317969) has the molecular formula C16H23N4O4S+ and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl-[2-oxo-2-(propan-2-ylamino)ethyl]-[[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]methyl]azanium.
| Compound Name | methyl-[2-oxo-2-(propan-2-ylamino)ethyl]-[[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 9317969 |
| Molecular Formula | C16H23N4O4S+ |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl-[2-oxo-2-(propan-2-ylamino)ethyl]-[[2,4,5-trioxo-3-(2-thiophen-2-ylethyl)imidazolidin-1-yl]methyl]azanium |
| SMILES | CC(C)NC(=O)C[NH+](C)CN1C(=O)C(=O)N(CCc2cccs2)C1=O |
| InChI | InChI=1S/C16H22N4O4S/c1-11(2)17-13(21)9-18(3)10-20-15(23)14(22)19(16(20)24)7-6-12-5-4-8-25-12/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,17,21)/p+1 |
| InChIKey | KIBKFCBWXMZTEA-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|