C15H19N3O4S — CID 9232063
1-[[(3S)-3-hydroxypiperidin-1-yl]methyl]-3-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione (PubChem CID 9232063) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-[[(3S)-3-hydroxypiperidin-1-yl]methyl]-3-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[(3S)-3-hydroxypiperidin-1-yl]methyl]-3-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9232063 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-[[(3S)-3-hydroxypiperidin-1-yl]methyl]-3-(2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CN2CCC[C@H](O)C2)C(=O)N1CCc1cccs1 |
| InChI | InChI=1S/C15H19N3O4S/c19-11-3-1-6-16(9-11)10-18-14(21)13(20)17(15(18)22)7-5-12-4-2-8-23-12/h2,4,8,11,19H,1,3,5-7,9-10H2/t11-/m0/s1 |
| InChIKey | DZRTYYNFSYEQIW-NSHDSACASA-N |
| XLogP | 0.50 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|