About cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium
cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium (PubChem CID 9318213) has the molecular formula C21H25N4O+
and a molecular weight of 349.46 g/mol. Its IUPAC name is cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium.
Molecular Properties
| Compound Name | cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium |
| PubChem CID | 9318213 |
| Molecular Formula | C21H25N4O+ |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC(C)c1ccc(C[NH+](Cn2nnc3ccccc3c2=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-15(2)17-9-7-16(8-10-17)13-24(18-11-12-18)14-25-21(26)19-5-3-4-6-20(19)22-23-25/h3-10,15,18H,11-14H2,1-2H3/p+1 |
| InChIKey | ZTWAHDKKORXWJE-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
The IUPAC name of cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium (CID 9318213) is cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium.
What is the SMILES notation for cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
The canonical SMILES for cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium is CC(C)c1ccc(C[NH+](Cn2nnc3ccccc3c2=O)C2CC2)cc1.
What is the InChIKey of cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
The InChIKey is ZTWAHDKKORXWJE-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H24N4O/c1-15(2)17-9-7-16(8-10-17)13-24(18-11-12-18)14-25-21(26)19-5-3-4-6-20(19)22-23-25/h3-10,15,18H,11-14H2,1-2H3/p+1.
What are the key properties of cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium has a molecular weight of 349.46 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium is sourced from PubChem (CID 9318213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).