C16H21N4OS2+ — CID 9325949
1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9325949) has the molecular formula C16H21N4OS2+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9325949 |
| Molecular Formula | C16H21N4OS2+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-[(5-methyl-2-sulfanylidene-1,3,4-thiadiazol-3-yl)methyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | Cc1nn(C[NH+]2CCC(C(=O)Nc3ccccc3)CC2)c(=S)s1 |
| InChI | InChI=1S/C16H20N4OS2/c1-12-18-20(16(22)23-12)11-19-9-7-13(8-10-19)15(21)17-14-5-3-2-4-6-14/h2-6,13H,7-11H2,1H3,(H,17,21)/p+1 |
| InChIKey | RDYSCBUPDDECCY-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|