C19H27N5O2S — CID 9327964
1-[(2S)-2-methylheptyl]-3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]thiourea (PubChem CID 9327964) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-[(2S)-2-methylheptyl]-3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]thiourea.
| Compound Name | 1-[(2S)-2-methylheptyl]-3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 9327964 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[(2S)-2-methylheptyl]-3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]thiourea |
| SMILES | CCCCC[C@H](C)CNC(=S)NNC(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H27N5O2S/c1-4-5-6-9-13(2)12-20-19(27)22-21-17(25)16-14-10-7-8-11-15(14)18(26)24(3)23-16/h7-8,10-11,13H,4-6,9,12H2,1-3H3,(H,21,25)(H2,20,22,27)/t13-/m0/s1 |
| InChIKey | FXQMFKJMEDVAHN-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|