C15H18N4O6 — CID 9328496
3,5-dimethoxy-N'-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzohydrazide (PubChem CID 9328496) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is 3,5-dimethoxy-N'-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzohydrazide.
| Compound Name | 3,5-dimethoxy-N'-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 9328496 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3,5-dimethoxy-N'-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)CN2C(=O)CN(C)C2=O)c1 |
| InChI | InChI=1S/C15H18N4O6/c1-18-8-13(21)19(15(18)23)7-12(20)16-17-14(22)9-4-10(24-2)6-11(5-9)25-3/h4-6H,7-8H2,1-3H3,(H,16,20)(H,17,22) |
| InChIKey | KYZIWGOKXYWKTE-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|