C24H24O6 — CID 9328528
(7-ethyl-2-oxochromen-4-yl)methyl 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate (PubChem CID 9328528) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 9328528 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate |
| SMILES | CCc1ccc2c(COC(=O)COc3cccc4c3OC(C)(C)C4)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24O6/c1-4-15-8-9-18-17(11-21(25)29-20(18)10-15)13-28-22(26)14-27-19-7-5-6-16-12-24(2,3)30-23(16)19/h5-11H,4,12-14H2,1-3H3 |
| InChIKey | KHNNSOQADCDVRY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|