C19H26N3O5S+ — CID 9333436
furan-2-ylmethyl-methyl-[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]azanium (PubChem CID 9333436) has the molecular formula C19H26N3O5S+ and a molecular weight of 408.50 g/mol. Its IUPAC name is furan-2-ylmethyl-methyl-[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]azanium.
| Compound Name | furan-2-ylmethyl-methyl-[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9333436 |
| Molecular Formula | C19H26N3O5S+ |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | furan-2-ylmethyl-methyl-[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)C[NH+](C)Cc1ccco1 |
| InChI | InChI=1S/C19H25N3O5S/c1-15-5-6-17(28(24,25)22-7-10-26-11-8-22)12-18(15)20-19(23)14-21(2)13-16-4-3-9-27-16/h3-6,9,12H,7-8,10-11,13-14H2,1-2H3,(H,20,23)/p+1 |
| InChIKey | DQVCTHVAQFHATK-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |