C17H16N2O2 — CID 9334013
(E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-prop-2-enylprop-2-enamide (PubChem CID 9334013) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is (E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 9334013 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)/C(C#N)=C/c1c(CC)oc2ccccc12 |
| InChI | InChI=1S/C17H16N2O2/c1-3-9-19-17(20)12(11-18)10-14-13-7-5-6-8-16(13)21-15(14)4-2/h3,5-8,10H,1,4,9H2,2H3,(H,19,20)/b12-10+ |
| InChIKey | YOYFKCBNHDZPED-ZRDIBKRKSA-N |
| XLogP | 3.20 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|