C20H17N3O4S — CID 9334274
(E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 9334274) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is (E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9334274 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (E)-2-cyano-3-(2-ethyl-1-benzofuran-3-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | CCc1oc2ccccc2c1/C=C(\C#N)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-2-18-17(16-5-3-4-6-19(16)27-18)11-13(12-21)20(24)23-14-7-9-15(10-8-14)28(22,25)26/h3-11H,2H2,1H3,(H,23,24)(H2,22,25,26)/b13-11+ |
| InChIKey | ISGIYCPDNVZTPJ-ACCUITESSA-N |
| XLogP | 3.19 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|