C28H50N4O2S — CID 93488701
(2S)-2-[(2S)-1-oxo-1-[(2E)-2-undec-10-enylidenehydrazinyl]propan-2-yl]sulfanyl-N-[(E)-undec-10-enylideneamino]propanamide (PubChem CID 93488701) has the molecular formula C28H50N4O2S and a molecular weight of 506.80 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-oxo-1-[(2E)-2-undec-10-enylidenehydrazinyl]propan-2-yl]sulfanyl-N-[(E)-undec-10-enylideneamino]propanamide.
| Compound Name | (2S)-2-[(2S)-1-oxo-1-[(2E)-2-undec-10-enylidenehydrazinyl]propan-2-yl]sulfanyl-N-[(E)-undec-10-enylideneamino]propanamide |
|---|---|
| PubChem CID | 93488701 |
| Molecular Formula | C28H50N4O2S |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | (2S)-2-[(2S)-1-oxo-1-[(2E)-2-undec-10-enylidenehydrazinyl]propan-2-yl]sulfanyl-N-[(E)-undec-10-enylideneamino]propanamide |
| SMILES | C=CCCCCCCCC/C=N/NC(=O)[C@H](C)S[C@@H](C)C(=O)N/N=C/CCCCCCCCC=C |
| InChI | InChI=1S/C28H50N4O2S/c1-5-7-9-11-13-15-17-19-21-23-29-31-27(33)25(3)35-26(4)28(34)32-30-24-22-20-18-16-14-12-10-8-6-2/h5-6,23-26H,1-2,7-22H2,3-4H3,(H,31,33)(H,32,34)/b29-23+,30-24+/t25-,26-/m0/s1 |
| InChIKey | HVFCKNMMWXWNFZ-MCMJRYKXSA-N |
| XLogP | 7.31 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|