C15H17ClFN2OS+ — CID 9357564
(5-chlorothiophen-2-yl)methyl-[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 9357564) has the molecular formula C15H17ClFN2OS+ and a molecular weight of 327.83 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 9357564 |
| Molecular Formula | C15H17ClFN2OS+ |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1)[NH+](C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClFN2OS/c1-10(19(2)9-13-7-8-14(16)21-13)15(20)18-12-5-3-11(17)4-6-12/h3-8,10H,9H2,1-2H3,(H,18,20)/p+1/t10-/m1/s1 |
| InChIKey | RCMLSGHPWLLFTD-SNVBAGLBSA-O |
| XLogP | 2.58 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |