C16H19N3O4 — CID 938653
2-[2-[(2R)-butan-2-yl]phenoxy]-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 938653) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[2-[(2R)-butan-2-yl]phenoxy]-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | 2-[2-[(2R)-butan-2-yl]phenoxy]-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 938653 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[2-[(2R)-butan-2-yl]phenoxy]-N-(2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CC[C@@H](C)c1ccccc1OCC(=O)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H19N3O4/c1-3-10(2)11-6-4-5-7-13(11)23-9-14(20)18-12-8-17-16(22)19-15(12)21/h4-8,10H,3,9H2,1-2H3,(H,18,20)(H2,17,19,21,22)/t10-/m1/s1 |
| InChIKey | JXANZFGYLXWYHZ-SNVBAGLBSA-N |
| XLogP | 1.59 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |