C18H22N4O3S — CID 9394841
4-methyl-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 9394841) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 9394841 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-methyl-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)N/N=C\c1ccc([C@H]2C[C@@H]2C)o1 |
| InChI | InChI=1S/C18H22N4O3S/c1-11-9-14(11)15-4-3-13(25-15)10-19-21-17(23)16-12(2)20-18(26-16)22-5-7-24-8-6-22/h3-4,10-11,14H,5-9H2,1-2H3,(H,21,23)/b19-10-/t11-,14-/m0/s1 |
| InChIKey | XKRJOWJRTHDCCP-LGUYXWDHSA-N |
| XLogP | 2.77 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|