C11H20N4O3 — CID 94000803
N-(2-methoxyethyl)-2-[methyl-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]amino]acetamide (PubChem CID 94000803) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[methyl-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[methyl-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 94000803 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[methyl-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]amino]acetamide |
| SMILES | COCCNC(=O)CN(C)[C@@H](C)c1nc(C)no1 |
| InChI | InChI=1S/C11H20N4O3/c1-8(11-13-9(2)14-18-11)15(3)7-10(16)12-5-6-17-4/h8H,5-7H2,1-4H3,(H,12,16)/t8-/m0/s1 |
| InChIKey | UURMFVWFDKXIMH-QMMMGPOBSA-N |
| XLogP | 0.13 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|