C15H13NO — CID 94034838
(5R)-4-azatetracyclo[10.2.2.01,5.06,11]hexadeca-6,8,10,13,15-pentaen-3-one (PubChem CID 94034838) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is (5R)-4-azatetracyclo[10.2.2.01,5.06,11]hexadeca-6,8,10,13,15-pentaen-3-one.
| Compound Name | (5R)-4-azatetracyclo[10.2.2.01,5.06,11]hexadeca-6,8,10,13,15-pentaen-3-one |
|---|---|
| PubChem CID | 94034838 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (5R)-4-azatetracyclo[10.2.2.01,5.06,11]hexadeca-6,8,10,13,15-pentaen-3-one |
| SMILES | O=C1CC23C=CC(C=C2)c2ccccc2[C@@H]3N1 |
| InChI | InChI=1S/C15H13NO/c17-13-9-15-7-5-10(6-8-15)11-3-1-2-4-12(11)14(15)16-13/h1-8,10,14H,9H2,(H,16,17)/t10?,14-,15?/m0/s1 |
| InChIKey | DQMPAYYFPBIXKO-CUMGRINNSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|