C22H15N5O4S2 — CID 94036572
4-(4-nitrophenyl)-2-[(3R)-3-(4-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazole (PubChem CID 94036572) has the molecular formula C22H15N5O4S2 and a molecular weight of 477.53 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2-[(3R)-3-(4-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazole.
| Compound Name | 4-(4-nitrophenyl)-2-[(3R)-3-(4-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 94036572 |
| Molecular Formula | C22H15N5O4S2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 4-(4-nitrophenyl)-2-[(3R)-3-(4-nitrophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(N3N=C(c4cccs4)C[C@@H]3c3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C22H15N5O4S2/c28-26(29)16-7-3-14(4-8-16)19-13-33-22(23-19)25-20(12-18(24-25)21-2-1-11-32-21)15-5-9-17(10-6-15)27(30)31/h1-11,13,20H,12H2/t20-/m1/s1 |
| InChIKey | OWNZGQVCPIAAMH-HXUWFJFHSA-N |
| XLogP | 6.04 |
| TPSA | 114.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|