C24H19N5O2S — CID 11476222
2-[5-(3-methylphenyl)-3-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-4-(4-nitrophenyl)-1,3-thiazole (PubChem CID 11476222) has the molecular formula C24H19N5O2S and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-[5-(3-methylphenyl)-3-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-4-(4-nitrophenyl)-1,3-thiazole.
| Compound Name | 2-[5-(3-methylphenyl)-3-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-4-(4-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 11476222 |
| Molecular Formula | C24H19N5O2S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[5-(3-methylphenyl)-3-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-4-(4-nitrophenyl)-1,3-thiazole |
| SMILES | Cc1cccc(C2=NN(c3nc(-c4ccc([N+](=O)[O-])cc4)cs3)C(c3cccnc3)C2)c1 |
| InChI | InChI=1S/C24H19N5O2S/c1-16-4-2-5-18(12-16)21-13-23(19-6-3-11-25-14-19)28(27-21)24-26-22(15-32-24)17-7-9-20(10-8-17)29(30)31/h2-12,14-15,23H,13H2,1H3 |
| InChIKey | YDLRNNGNHYZZLE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 84.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|