C26H22BrIN4O2S — CID 2839774
2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-iodophenyl)-1,3-thiazole;hydrobromide (PubChem CID 2839774) has the molecular formula C26H22BrIN4O2S and a molecular weight of 661.36 g/mol. Its IUPAC name is 2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-iodophenyl)-1,3-thiazole;hydrobromide.
| Compound Name | 2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-iodophenyl)-1,3-thiazole;hydrobromide |
|---|---|
| PubChem CID | 2839774 |
| Molecular Formula | C26H22BrIN4O2S |
| Molecular Weight | 661.36 g/mol |
| Exact Mass | 659.97 |
| IUPAC Name | 2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-iodophenyl)-1,3-thiazole;hydrobromide |
| SMILES | Br.Cc1ccc(C)c(C2=NN(c3nc(-c4ccc(I)cc4)cs3)C(c3cccc([N+](=O)[O-])c3)C2)c1 |
| InChI | InChI=1S/C26H21IN4O2S.BrH/c1-16-6-7-17(2)22(12-16)23-14-25(19-4-3-5-21(13-19)31(32)33)30(29-23)26-28-24(15-34-26)18-8-10-20(27)11-9-18;/h3-13,15,25H,14H2,1-2H3;1H |
| InChIKey | SJUSKTGHRGZJRD-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.36 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|