C35H30N4O4S — CID 4191186
[4-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-5-ethyl-1,3-thiazol-4-yl]phenyl] benzoate (PubChem CID 4191186) has the molecular formula C35H30N4O4S and a molecular weight of 602.72 g/mol. Its IUPAC name is [4-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-5-ethyl-1,3-thiazol-4-yl]phenyl] benzoate.
| Compound Name | [4-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-5-ethyl-1,3-thiazol-4-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 4191186 |
| Molecular Formula | C35H30N4O4S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | [4-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-5-ethyl-1,3-thiazol-4-yl]phenyl] benzoate |
| SMILES | CCc1sc(N2N=C(c3cc(C)ccc3C)CC2c2cccc([N+](=O)[O-])c2)nc1-c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H30N4O4S/c1-4-32-33(24-15-17-28(18-16-24)43-34(40)25-9-6-5-7-10-25)36-35(44-32)38-31(26-11-8-12-27(20-26)39(41)42)21-30(37-38)29-19-22(2)13-14-23(29)3/h5-20,31H,4,21H2,1-3H3 |
| InChIKey | LNWSALLUCHQYHL-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|