C32H26N4O2S — CID 98236272
2-[(3R)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole (PubChem CID 98236272) has the molecular formula C32H26N4O2S and a molecular weight of 530.65 g/mol. Its IUPAC name is 2-[(3R)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole.
| Compound Name | 2-[(3R)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 98236272 |
| Molecular Formula | C32H26N4O2S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-[(3R)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-phenylphenyl)-1,3-thiazole |
| SMILES | Cc1ccc(C)c(C2=NN(c3nc(-c4ccc(-c5ccccc5)cc4)cs3)[C@@H](c3cccc([N+](=O)[O-])c3)C2)c1 |
| InChI | InChI=1S/C32H26N4O2S/c1-21-11-12-22(2)28(17-21)29-19-31(26-9-6-10-27(18-26)36(37)38)35(34-29)32-33-30(20-39-32)25-15-13-24(14-16-25)23-7-4-3-5-8-23/h3-18,20,31H,19H2,1-2H3/t31-/m1/s1 |
| InChIKey | VAJDBERCOBTIRR-WJOKGBTCSA-N |
| XLogP | 8.36 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|