C27H23FN4O2S — CID 92652673
2-[(3S)-5-(4-fluorophenyl)-3-(4-propan-2-ylphenyl)-3,4-dihydropyrazol-2-yl]-4-(3-nitrophenyl)-1,3-thiazole (PubChem CID 92652673) has the molecular formula C27H23FN4O2S and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[(3S)-5-(4-fluorophenyl)-3-(4-propan-2-ylphenyl)-3,4-dihydropyrazol-2-yl]-4-(3-nitrophenyl)-1,3-thiazole.
| Compound Name | 2-[(3S)-5-(4-fluorophenyl)-3-(4-propan-2-ylphenyl)-3,4-dihydropyrazol-2-yl]-4-(3-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 92652673 |
| Molecular Formula | C27H23FN4O2S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-[(3S)-5-(4-fluorophenyl)-3-(4-propan-2-ylphenyl)-3,4-dihydropyrazol-2-yl]-4-(3-nitrophenyl)-1,3-thiazole |
| SMILES | CC(C)c1ccc([C@@H]2CC(c3ccc(F)cc3)=NN2c2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C27H23FN4O2S/c1-17(2)18-6-8-20(9-7-18)26-15-24(19-10-12-22(28)13-11-19)30-31(26)27-29-25(16-35-27)21-4-3-5-23(14-21)32(33)34/h3-14,16-17,26H,15H2,1-2H3/t26-/m0/s1 |
| InChIKey | NFBOZBFJLKAIFU-SANMLTNESA-N |
| XLogP | 7.34 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|