C31H30Br2N4O5S — CID 146050821
propan-2-yl 2-[4-bromo-2-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]phenoxy]acetate;hydrobromide (PubChem CID 146050821) has the molecular formula C31H30Br2N4O5S and a molecular weight of 730.48 g/mol. Its IUPAC name is propan-2-yl 2-[4-bromo-2-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]phenoxy]acetate;hydrobromide.
| Compound Name | propan-2-yl 2-[4-bromo-2-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]phenoxy]acetate;hydrobromide |
|---|---|
| PubChem CID | 146050821 |
| Molecular Formula | C31H30Br2N4O5S |
| Molecular Weight | 730.48 g/mol |
| Exact Mass | 728.03 |
| IUPAC Name | propan-2-yl 2-[4-bromo-2-[2-[5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]phenoxy]acetate;hydrobromide |
| SMILES | Br.Cc1ccc(C)c(C2=NN(c3nc(-c4cc(Br)ccc4OCC(=O)OC(C)C)cs3)C(c3cccc([N+](=O)[O-])c3)C2)c1 |
| InChI | InChI=1S/C31H29BrN4O5S.BrH/c1-18(2)41-30(37)16-40-29-11-10-22(32)14-25(29)27-17-42-31(33-27)35-28(21-6-5-7-23(13-21)36(38)39)15-26(34-35)24-12-19(3)8-9-20(24)4;/h5-14,17-18,28H,15-16H2,1-4H3;1H |
| InChIKey | TYVYVUFEPCZHSI-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.48 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|