C30H29N5O4S2 — CID 40732325
2-[(3S)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazole (PubChem CID 40732325) has the molecular formula C30H29N5O4S2 and a molecular weight of 587.73 g/mol. Its IUPAC name is 2-[(3S)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazole.
| Compound Name | 2-[(3S)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 40732325 |
| Molecular Formula | C30H29N5O4S2 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 2-[(3S)-5-(2,5-dimethylphenyl)-3-(3-nitrophenyl)-3,4-dihydropyrazol-2-yl]-4-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3-thiazole |
| SMILES | Cc1ccc(C)c(C2=NN(c3nc(-c4ccc(S(=O)(=O)N5CCCC5)cc4)cs3)[C@H](c3cccc([N+](=O)[O-])c3)C2)c1 |
| InChI | InChI=1S/C30H29N5O4S2/c1-20-8-9-21(2)26(16-20)27-18-29(23-6-5-7-24(17-23)35(36)37)34(32-27)30-31-28(19-40-30)22-10-12-25(13-11-22)41(38,39)33-14-3-4-15-33/h5-13,16-17,19,29H,3-4,14-15,18H2,1-2H3/t29-/m0/s1 |
| InChIKey | FWKDCNDSFUVKCN-LJAQVGFWSA-N |
| XLogP | 6.48 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|