C16H18FN5OS — CID 94044556
1-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(pyrazin-2-ylamino)ethyl]urea (PubChem CID 94044556) has the molecular formula C16H18FN5OS and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(pyrazin-2-ylamino)ethyl]urea.
| Compound Name | 1-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(pyrazin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 94044556 |
| Molecular Formula | C16H18FN5OS |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(pyrazin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1cnccn1)N[C@H]1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C16H18FN5OS/c17-11-1-2-14-12(9-11)13(3-8-24-14)22-16(23)21-7-6-20-15-10-18-4-5-19-15/h1-2,4-5,9-10,13H,3,6-8H2,(H,19,20)(H2,21,22,23)/t13-/m0/s1 |
| InChIKey | BUCFQAXBCCOSSR-ZDUSSCGKSA-N |
| XLogP | 2.56 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|