C15H19N3O3S — CID 9404499
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 9404499) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 9404499 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H19N3O3S/c1-4-11-14(22-18-17-11)15(19)16-8-7-10-5-6-12(20-2)13(9-10)21-3/h5-6,9H,4,7-8H2,1-3H3,(H,16,19) |
| InChIKey | FQOIBVVIYOBIKZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |