C18H24N4O4S — CID 9406601
N-[3-(butylsulfamoyl)phenyl]-2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 9406601) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 9406601 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)Cc2c(C)nc(=O)[nH]c2C)c1 |
| InChI | InChI=1S/C18H24N4O4S/c1-4-5-9-19-27(25,26)15-8-6-7-14(10-15)22-17(23)11-16-12(2)20-18(24)21-13(16)3/h6-8,10,19H,4-5,9,11H2,1-3H3,(H,22,23)(H,20,21,24) |
| InChIKey | MWLNIBBBIGZRFP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|